C30H43NO4Si — CID 23563625
(1R,3R,4R)-3-[(1S)-1-acetamido-3-methylbutyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentane-1-carboxylic acid (PubChem CID 23563625) has the molecular formula C30H43NO4Si and a molecular weight of 509.76 g/mol. Its IUPAC name is (1R,3R,4R)-3-[(1S)-1-acetamido-3-methylbutyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentane-1-carboxylic acid.
| Compound Name | (1R,3R,4R)-3-[(1S)-1-acetamido-3-methylbutyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 23563625 |
| Molecular Formula | C30H43NO4Si |
| Molecular Weight | 509.76 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | (1R,3R,4R)-3-[(1S)-1-acetamido-3-methylbutyl]-4-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopentane-1-carboxylic acid |
| SMILES | CC(=O)N[C@@H](CC(C)C)[C@@H]1C[C@@H](C(=O)O)C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H43NO4Si/c1-21(2)17-28(31-22(3)32)27-19-23(29(33)34)18-24(27)20-35-36(30(4,5)6,25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-16,21,23-24,27-28H,17-20H2,1-6H3,(H,31,32)(H,33,34)/t23-,24-,27+,28-/m0/s1 |
| InChIKey | MZBYQEQRLHIHJJ-ACWWYGLDSA-N |
| XLogP | 4.84 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.76 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|