C9H14F5KN2O4S — CID 23563876
potassium 2-[methyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]amino]ethanesulfonate (PubChem CID 23563876) has the molecular formula C9H14F5KN2O4S and a molecular weight of 380.38 g/mol. Its IUPAC name is potassium 2-[methyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]amino]ethanesulfonate.
| Compound Name | potassium 2-[methyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 23563876 |
| Molecular Formula | C9H14F5KN2O4S |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | potassium 2-[methyl-[3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]amino]ethanesulfonate |
| SMILES | CN(CCCNC(=O)C(F)(F)C(F)(F)F)CCS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C9H15F5N2O4S.K/c1-16(5-6-21(18,19)20)4-2-3-15-7(17)8(10,11)9(12,13)14;/h2-6H2,1H3,(H,15,17)(H,18,19,20);/q;+1/p-1 |
| InChIKey | YMDKJPXACGCKAD-UHFFFAOYSA-M |
| XLogP | -2.83 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|