3-ethylpentyl hydrogen sulfate

C7H16O4S — CID 23563892

IUPAC3-ethylpentyl hydrogen sulfate
SMILESCCC(CC)CCOS(=O)(=O)O
InChIInChI=1S/C7H16O4S/c1-3-7(4-2)5-6-11-12(8,9)10/h7H,3-6H2,1-2H3,(H,8,9,10)
InChIKeyWJPHIZMTXNBRTQ-UHFFFAOYSA-N
MW196.27 g/mol
LogP1.63
Rot. Bonds6

About 3-ethylpentyl hydrogen sulfate

3-ethylpentyl hydrogen sulfate (PubChem CID 23563892) has the molecular formula C7H16O4S and a molecular weight of 196.27 g/mol. Its IUPAC name is 3-ethylpentyl hydrogen sulfate.

Molecular Properties

Compound Name3-ethylpentyl hydrogen sulfate
PubChem CID23563892
Molecular FormulaC7H16O4S
Molecular Weight196.27 g/mol
Exact Mass196.08
IUPAC Name3-ethylpentyl hydrogen sulfate
SMILESCCC(CC)CCOS(=O)(=O)O
InChIInChI=1S/C7H16O4S/c1-3-7(4-2)5-6-11-12(8,9)10/h7H,3-6H2,1-2H3,(H,8,9,10)
InChIKeyWJPHIZMTXNBRTQ-UHFFFAOYSA-N
XLogP1.63
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.27
LogP ≤ 51.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-ethylpentyl hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethylpentyl hydrogen sulfate?
The IUPAC name of 3-ethylpentyl hydrogen sulfate (CID 23563892) is 3-ethylpentyl hydrogen sulfate.
What is the SMILES notation for 3-ethylpentyl hydrogen sulfate?
The canonical SMILES for 3-ethylpentyl hydrogen sulfate is CCC(CC)CCOS(=O)(=O)O.
What is the InChIKey of 3-ethylpentyl hydrogen sulfate?
The InChIKey is WJPHIZMTXNBRTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O4S/c1-3-7(4-2)5-6-11-12(8,9)10/h7H,3-6H2,1-2H3,(H,8,9,10).
What are the key properties of 3-ethylpentyl hydrogen sulfate?
3-ethylpentyl hydrogen sulfate has a molecular weight of 196.27 g/mol, XLogP of 1.63, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpentyl hydrogen sulfate is sourced from PubChem (CID 23563892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).