About sodium butane-1-sulfinate
sodium butane-1-sulfinate (PubChem CID 23563922) has the molecular formula C4H9NaO2S
and a molecular weight of 144.17 g/mol. Its IUPAC name is sodium butane-1-sulfinate.
Molecular Properties
| Compound Name | sodium butane-1-sulfinate |
| PubChem CID | 23563922 |
| Molecular Formula | C4H9NaO2S |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.02 |
| IUPAC Name | sodium butane-1-sulfinate |
| SMILES | CCCCS(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H10O2S.Na/c1-2-3-4-7(5)6;/h2-4H2,1H3,(H,5,6);/q;+1/p-1 |
| InChIKey | VTAJDQFLLQYMCM-UHFFFAOYSA-M |
| XLogP | -2.33 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium butane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium butane-1-sulfinate?
The IUPAC name of sodium butane-1-sulfinate (CID 23563922) is sodium butane-1-sulfinate.
What is the SMILES notation for sodium butane-1-sulfinate?
The canonical SMILES for sodium butane-1-sulfinate is CCCCS(=O)[O-].[Na+].
What is the InChIKey of sodium butane-1-sulfinate?
The InChIKey is VTAJDQFLLQYMCM-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10O2S.Na/c1-2-3-4-7(5)6;/h2-4H2,1H3,(H,5,6);/q;+1/p-1.
What are the key properties of sodium butane-1-sulfinate?
sodium butane-1-sulfinate has a molecular weight of 144.17 g/mol, XLogP of -2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium butane-1-sulfinate is sourced from PubChem (CID 23563922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).