C11H17N6O2S+ — CID 23563973
2-[[4-amino-6-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1,3,5-triazin-2-yl]sulfanyl]acetic acid (PubChem CID 23563973) has the molecular formula C11H17N6O2S+ and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-[[4-amino-6-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1,3,5-triazin-2-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[4-amino-6-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1,3,5-triazin-2-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 23563973 |
| Molecular Formula | C11H17N6O2S+ |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 2-[[4-amino-6-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-1,3,5-triazin-2-yl]sulfanyl]acetic acid |
| SMILES | Nc1nc(SCC(=O)O)nc([N+]23CCN(CC2)CC3)n1 |
| InChI | InChI=1S/C11H16N6O2S/c12-9-13-10(15-11(14-9)20-7-8(18)19)17-4-1-16(2-5-17)3-6-17/h1-7H2,(H2-,12,13,14,15,18,19)/p+1 |
| InChIKey | XBUKJHRNVUJYPD-UHFFFAOYSA-O |
| XLogP | -0.73 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|