C21H42 — CID 23565911
1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecamethylcycloheptane (PubChem CID 23565911) has the molecular formula C21H42 and a molecular weight of 294.57 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecamethylcycloheptane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecamethylcycloheptane |
|---|---|
| PubChem CID | 23565911 |
| Molecular Formula | C21H42 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 294.33 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7-tetradecamethylcycloheptane |
| SMILES | CC1(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C(C)(C)C1(C)C |
| InChI | InChI=1S/C21H42/c1-15(2)16(3,4)18(7,8)20(11,12)21(13,14)19(9,10)17(15,5)6/h1-14H3 |
| InChIKey | UETIERVOEGYJTG-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |