C15H10Cl2FNO3 — CID 2356595
[2-(2-fluoroanilino)-2-oxoethyl] 2,6-dichlorobenzoate (PubChem CID 2356595) has the molecular formula C15H10Cl2FNO3 and a molecular weight of 342.15 g/mol. Its IUPAC name is [2-(2-fluoroanilino)-2-oxoethyl] 2,6-dichlorobenzoate.
| Compound Name | [2-(2-fluoroanilino)-2-oxoethyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 2356595 |
| Molecular Formula | C15H10Cl2FNO3 |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | [2-(2-fluoroanilino)-2-oxoethyl] 2,6-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1c(Cl)cccc1Cl)Nc1ccccc1F |
| InChI | InChI=1S/C15H10Cl2FNO3/c16-9-4-3-5-10(17)14(9)15(21)22-8-13(20)19-12-7-2-1-6-11(12)18/h1-7H,8H2,(H,19,20) |
| InChIKey | KJLACVQZLVAXCI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |