About ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate
ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate (PubChem CID 23567154) has the molecular formula C13H13ClO3
and a molecular weight of 252.70 g/mol. Its IUPAC name is ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate |
| PubChem CID | 23567154 |
| Molecular Formula | C13H13ClO3 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate |
| SMILES | CCOC(=O)C1CC=Cc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C13H13ClO3/c1-2-16-13(15)12-5-3-4-9-8-10(14)6-7-11(9)17-12/h3-4,6-8,12H,2,5H2,1H3 |
| InChIKey | ZDZNIKPLLZLAEX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate?
The IUPAC name of ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate (CID 23567154) is ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate.
What is the SMILES notation for ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate?
The canonical SMILES for ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate is CCOC(=O)C1CC=Cc2cc(Cl)ccc2O1.
What is the InChIKey of ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate?
The InChIKey is ZDZNIKPLLZLAEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClO3/c1-2-16-13(15)12-5-3-4-9-8-10(14)6-7-11(9)17-12/h3-4,6-8,12H,2,5H2,1H3.
What are the key properties of ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate?
ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate has a molecular weight of 252.70 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 7-chloro-2,3-dihydro-1-benzoxepine-2-carboxylate is sourced from PubChem (CID 23567154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).