C24H26Cl2F3N5O — CID 23567263
1-[2-(3,4-dichlorophenyl)-4-[2-(1-methylimidazol-4-yl)ethylamino]butyl]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 23567263) has the molecular formula C24H26Cl2F3N5O and a molecular weight of 528.41 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)-4-[2-(1-methylimidazol-4-yl)ethylamino]butyl]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[2-(3,4-dichlorophenyl)-4-[2-(1-methylimidazol-4-yl)ethylamino]butyl]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 23567263 |
| Molecular Formula | C24H26Cl2F3N5O |
| Molecular Weight | 528.41 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)-4-[2-(1-methylimidazol-4-yl)ethylamino]butyl]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | Cn1cnc(CCNCCC(CNC(=O)Nc2cccc(C(F)(F)F)c2)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C24H26Cl2F3N5O/c1-34-14-20(32-15-34)8-10-30-9-7-17(16-5-6-21(25)22(26)11-16)13-31-23(35)33-19-4-2-3-18(12-19)24(27,28)29/h2-6,11-12,14-15,17,30H,7-10,13H2,1H3,(H2,31,33,35) |
| InChIKey | JWNOCJKRPGUGKV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.41 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|