C25H25Cl2F6N5O — CID 23567420
1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(3,4-dichlorophenyl)-4-[2-(1-methylimidazol-4-yl)ethylamino]butyl]urea (PubChem CID 23567420) has the molecular formula C25H25Cl2F6N5O and a molecular weight of 596.40 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(3,4-dichlorophenyl)-4-[2-(1-methylimidazol-4-yl)ethylamino]butyl]urea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(3,4-dichlorophenyl)-4-[2-(1-methylimidazol-4-yl)ethylamino]butyl]urea |
|---|---|
| PubChem CID | 23567420 |
| Molecular Formula | C25H25Cl2F6N5O |
| Molecular Weight | 596.40 g/mol |
| Exact Mass | 595.13 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[2-(3,4-dichlorophenyl)-4-[2-(1-methylimidazol-4-yl)ethylamino]butyl]urea |
| SMILES | Cn1cnc(CCNCCC(CNC(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C25H25Cl2F6N5O/c1-38-13-19(36-14-38)5-7-34-6-4-16(15-2-3-21(26)22(27)8-15)12-35-23(39)37-20-10-17(24(28,29)30)9-18(11-20)25(31,32)33/h2-3,8-11,13-14,16,34H,4-7,12H2,1H3,(H2,35,37,39) |
| InChIKey | ZWQXJUXZXPSLGQ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.40 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|