C29H36Cl2N4O2 — CID 23567494
1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-[4-(2-methoxyphenyl)phenyl]butyl]urea (PubChem CID 23567494) has the molecular formula C29H36Cl2N4O2 and a molecular weight of 543.54 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-[4-(2-methoxyphenyl)phenyl]butyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-[4-(2-methoxyphenyl)phenyl]butyl]urea |
|---|---|
| PubChem CID | 23567494 |
| Molecular Formula | C29H36Cl2N4O2 |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[4-[3-(dimethylamino)propylamino]-2-[4-(2-methoxyphenyl)phenyl]butyl]urea |
| SMILES | COc1ccccc1-c1ccc(C(CCNCCCN(C)C)CNC(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C29H36Cl2N4O2/c1-35(2)16-6-14-32-15-13-23(20-33-29(36)34-26-18-24(30)17-25(31)19-26)21-9-11-22(12-10-21)27-7-4-5-8-28(27)37-3/h4-5,7-12,17-19,23,32H,6,13-16,20H2,1-3H3,(H2,33,34,36) |
| InChIKey | MJLLYVFMLZVBCM-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|