C18H28O2 — CID 23567736
(2Z,6E)-cyclooctadeca-2,6-diene-1,8-dione (PubChem CID 23567736) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (2Z,6E)-cyclooctadeca-2,6-diene-1,8-dione.
| Compound Name | (2Z,6E)-cyclooctadeca-2,6-diene-1,8-dione |
|---|---|
| PubChem CID | 23567736 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (2Z,6E)-cyclooctadeca-2,6-diene-1,8-dione |
| SMILES | O=C1/C=C\CC/C=C/C(=O)CCCCCCCCCC1 |
| InChI | InChI=1S/C18H28O2/c19-17-13-9-5-3-1-2-4-6-10-14-18(20)16-12-8-7-11-15-17/h11-12,15-16H,1-10,13-14H2/b15-11-,16-12+ |
| InChIKey | OMOIRKHMSJBRMG-UKVBVZPVSA-N |
| XLogP | 4.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |