C22H27FN4 — CID 23567868
10-(4-fluoro-2-methylphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 23567868) has the molecular formula C22H27FN4 and a molecular weight of 366.48 g/mol. Its IUPAC name is 10-(4-fluoro-2-methylphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 10-(4-fluoro-2-methylphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 23567868 |
| Molecular Formula | C22H27FN4 |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 10-(4-fluoro-2-methylphenyl)-11-methyl-N-pentan-3-yl-1,8,12-triazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4ccc(F)cc4C)c(C)nn13)CCC2 |
| InChI | InChI=1S/C22H27FN4/c1-5-16(6-2)24-21-18-8-7-9-19(18)25-22-20(14(4)26-27(21)22)17-11-10-15(23)12-13(17)3/h10-12,16,24H,5-9H2,1-4H3 |
| InChIKey | LFGLYBJFAWVWAJ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |