About (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile
(3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile (PubChem CID 23567928) has the molecular formula C13H27NOSi
and a molecular weight of 241.45 g/mol. Its IUPAC name is (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile.
Molecular Properties
| Compound Name | (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile |
| PubChem CID | 23567928 |
| Molecular Formula | C13H27NOSi |
| Molecular Weight | 241.45 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)[C@H](O)CC[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H27NOSi/c1-12(2,3)16(6,7)9-8-11(15)13(4,5)10-14/h11,15H,8-9H2,1-7H3/t11-/m1/s1 |
| InChIKey | JTIVXYLIIJDSIO-LLVKDONJSA-N |
| XLogP | 3.80 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile?
The IUPAC name of (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile (CID 23567928) is (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile.
What is the SMILES notation for (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile?
The canonical SMILES for (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile is CC(C)(C#N)[C@H](O)CC[Si](C)(C)C(C)(C)C.
What is the InChIKey of (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile?
The InChIKey is JTIVXYLIIJDSIO-LLVKDONJSA-N. The full InChI is InChI=1S/C13H27NOSi/c1-12(2,3)16(6,7)9-8-11(15)13(4,5)10-14/h11,15H,8-9H2,1-7H3/t11-/m1/s1.
What are the key properties of (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile?
(3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile has a molecular weight of 241.45 g/mol, XLogP of 3.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-[tert-butyl(dimethyl)silyl]-3-hydroxy-2,2-dimethylpentanenitrile is sourced from PubChem (CID 23567928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).