C8H16FNO3 — CID 23567967
tert-butyl-[(2S)-2-fluoro-3-hydroxypropyl]carbamic acid (PubChem CID 23567967) has the molecular formula C8H16FNO3 and a molecular weight of 193.22 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-fluoro-3-hydroxypropyl]carbamic acid.
| Compound Name | tert-butyl-[(2S)-2-fluoro-3-hydroxypropyl]carbamic acid |
|---|---|
| PubChem CID | 23567967 |
| Molecular Formula | C8H16FNO3 |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | tert-butyl-[(2S)-2-fluoro-3-hydroxypropyl]carbamic acid |
| SMILES | CC(C)(C)N(C[C@H](F)CO)C(=O)O |
| InChI | InChI=1S/C8H16FNO3/c1-8(2,3)10(7(12)13)4-6(9)5-11/h6,11H,4-5H2,1-3H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | KEUBATKZAAEMSN-LURJTMIESA-N |
| XLogP | 1.10 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |