C11H13N3O7S3 — CID 23568069
2-[5-(methanesulfonamido)-3-methylpyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfinic acid (PubChem CID 23568069) has the molecular formula C11H13N3O7S3 and a molecular weight of 395.44 g/mol. Its IUPAC name is 2-[5-(methanesulfonamido)-3-methylpyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfinic acid.
| Compound Name | 2-[5-(methanesulfonamido)-3-methylpyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfinic acid |
|---|---|
| PubChem CID | 23568069 |
| Molecular Formula | C11H13N3O7S3 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 2-[5-(methanesulfonamido)-3-methylpyrazol-1-yl]-4-(trioxidanylsulfanyl)benzenesulfinic acid |
| SMILES | Cc1cc(NS(C)(=O)=O)n(-c2cc(SOOO)ccc2S(=O)O)n1 |
| InChI | InChI=1S/C11H13N3O7S3/c1-7-5-11(13-24(2,18)19)14(12-7)9-6-8(22-21-20-15)3-4-10(9)23(16)17/h3-6,13,15H,1-2H3,(H,16,17) |
| InChIKey | XFZNGFJLWSIPEI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|