C14H6F5N3O — CID 2356826
5-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one (PubChem CID 2356826) has the molecular formula C14H6F5N3O and a molecular weight of 327.21 g/mol. Its IUPAC name is 5-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one.
| Compound Name | 5-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 2356826 |
| Molecular Formula | C14H6F5N3O |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 327.04 |
| IUPAC Name | 5-[(2,3,4,5,6-pentafluorophenyl)methylideneamino]-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(/N=C/c3c(F)c(F)c(F)c(F)c3F)cc2[nH]1 |
| InChI | InChI=1S/C14H6F5N3O/c15-9-6(10(16)12(18)13(19)11(9)17)4-20-5-1-2-7-8(3-5)22-14(23)21-7/h1-4H,(H2,21,22,23)/b20-4+ |
| InChIKey | OMWMHMZXKCXFKL-LRNAUUFOSA-N |
| XLogP | 3.30 |
| TPSA | 61.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|