About cyclopentene-1,3-diamine
cyclopentene-1,3-diamine (PubChem CID 23568360) has the molecular formula C5H10N2
and a molecular weight of 98.15 g/mol. Its IUPAC name is cyclopentene-1,3-diamine.
Molecular Properties
| Compound Name | cyclopentene-1,3-diamine |
| PubChem CID | 23568360 |
| Molecular Formula | C5H10N2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | cyclopentene-1,3-diamine |
| SMILES | NC1=CC(N)CC1 |
| InChI | InChI=1S/C5H10N2/c6-4-1-2-5(7)3-4/h3-4H,1-2,6-7H2 |
| InChIKey | BRUDYGDPGIDYBH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopentene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentene-1,3-diamine?
The IUPAC name of cyclopentene-1,3-diamine (CID 23568360) is cyclopentene-1,3-diamine.
What is the SMILES notation for cyclopentene-1,3-diamine?
The canonical SMILES for cyclopentene-1,3-diamine is NC1=CC(N)CC1.
What is the InChIKey of cyclopentene-1,3-diamine?
The InChIKey is BRUDYGDPGIDYBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2/c6-4-1-2-5(7)3-4/h3-4H,1-2,6-7H2.
What are the key properties of cyclopentene-1,3-diamine?
cyclopentene-1,3-diamine has a molecular weight of 98.15 g/mol, XLogP of -0.05, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentene-1,3-diamine is sourced from PubChem (CID 23568360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).