About 5-methoxy-3-methyl-1,2,4-oxadiazole
5-methoxy-3-methyl-1,2,4-oxadiazole (PubChem CID 23568550) has the molecular formula C4H6N2O2
and a molecular weight of 114.10 g/mol. Its IUPAC name is 5-methoxy-3-methyl-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 5-methoxy-3-methyl-1,2,4-oxadiazole |
| PubChem CID | 23568550 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | 5-methoxy-3-methyl-1,2,4-oxadiazole |
| SMILES | COc1nc(C)no1 |
| InChI | InChI=1S/C4H6N2O2/c1-3-5-4(7-2)8-6-3/h1-2H3 |
| InChIKey | XKYQCTVQVCBFHW-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methoxy-3-methyl-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3-methyl-1,2,4-oxadiazole?
The IUPAC name of 5-methoxy-3-methyl-1,2,4-oxadiazole (CID 23568550) is 5-methoxy-3-methyl-1,2,4-oxadiazole.
What is the SMILES notation for 5-methoxy-3-methyl-1,2,4-oxadiazole?
The canonical SMILES for 5-methoxy-3-methyl-1,2,4-oxadiazole is COc1nc(C)no1.
What is the InChIKey of 5-methoxy-3-methyl-1,2,4-oxadiazole?
The InChIKey is XKYQCTVQVCBFHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2/c1-3-5-4(7-2)8-6-3/h1-2H3.
What are the key properties of 5-methoxy-3-methyl-1,2,4-oxadiazole?
5-methoxy-3-methyl-1,2,4-oxadiazole has a molecular weight of 114.10 g/mol, XLogP of 0.39, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3-methyl-1,2,4-oxadiazole is sourced from PubChem (CID 23568550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).