C26H36Cl2N2O — CID 23568989
4-[[[4-(3,4-dichlorophenyl)-3-(2,2-dimethyloxan-4-yl)butyl]amino]methyl]-N,N-dimethylaniline (PubChem CID 23568989) has the molecular formula C26H36Cl2N2O and a molecular weight of 463.49 g/mol. Its IUPAC name is 4-[[[4-(3,4-dichlorophenyl)-3-(2,2-dimethyloxan-4-yl)butyl]amino]methyl]-N,N-dimethylaniline.
| Compound Name | 4-[[[4-(3,4-dichlorophenyl)-3-(2,2-dimethyloxan-4-yl)butyl]amino]methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 23568989 |
| Molecular Formula | C26H36Cl2N2O |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 4-[[[4-(3,4-dichlorophenyl)-3-(2,2-dimethyloxan-4-yl)butyl]amino]methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(CNCCC(Cc2ccc(Cl)c(Cl)c2)C2CCOC(C)(C)C2)cc1 |
| InChI | InChI=1S/C26H36Cl2N2O/c1-26(2)17-22(12-14-31-26)21(15-20-7-10-24(27)25(28)16-20)11-13-29-18-19-5-8-23(9-6-19)30(3)4/h5-10,16,21-22,29H,11-15,17-18H2,1-4H3 |
| InChIKey | SRNITTPVCFSAPL-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|