C14H15N3O — CID 23569050
2,4,6-trimethyl-3-(pyrazin-2-ylmethylideneamino)phenol (PubChem CID 23569050) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 2,4,6-trimethyl-3-(pyrazin-2-ylmethylideneamino)phenol.
| Compound Name | 2,4,6-trimethyl-3-(pyrazin-2-ylmethylideneamino)phenol |
|---|---|
| PubChem CID | 23569050 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 2,4,6-trimethyl-3-(pyrazin-2-ylmethylideneamino)phenol |
| SMILES | Cc1cc(C)c(/N=C/c2cnccn2)c(C)c1O |
| InChI | InChI=1S/C14H15N3O/c1-9-6-10(2)14(18)11(3)13(9)17-8-12-7-15-4-5-16-12/h4-8,18H,1-3H3/b17-8+ |
| InChIKey | MMBBLOVQARDROI-CAOOACKPSA-N |
| XLogP | 2.86 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|