About iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide
iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide (PubChem CID 23569953) has the molecular formula C29H19IrN2O
and a molecular weight of 603.70 g/mol. Its IUPAC name is iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide.
Molecular Properties
| Compound Name | iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide |
| PubChem CID | 23569953 |
| Molecular Formula | C29H19IrN2O |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 604.11 |
| IUPAC Name | iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide |
| SMILES | [Ir+3].[c-]1cccc2c1N(c1ccccn1)c1ccccc1O2.[c-]1ccccc1-c1[c-]cccc1 |
| InChI | InChI=1S/C17H11N2O.C12H8.Ir/c1-3-9-15-13(7-1)19(17-11-5-6-12-18-17)14-8-2-4-10-16(14)20-15;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-7,9-12H;1-7,9H;/q-1;-2;+3 |
| InChIKey | KJTPMMALRTVGKT-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide?
The IUPAC name of iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide (CID 23569953) is iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide.
What is the SMILES notation for iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide?
The canonical SMILES for iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide is [Ir+3].[c-]1cccc2c1N(c1ccccn1)c1ccccc1O2.[c-]1ccccc1-c1[c-]cccc1.
What is the InChIKey of iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide?
The InChIKey is KJTPMMALRTVGKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N2O.C12H8.Ir/c1-3-9-15-13(7-1)19(17-11-5-6-12-18-17)14-8-2-4-10-16(14)20-15;1-3-7-11(8-4-1)12-9-5-2-6-10-12;/h1-7,9-12H;1-7,9H;/q-1;-2;+3.
What are the key properties of iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide?
iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide has a molecular weight of 603.70 g/mol, XLogP of 7.41, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iridium(3+);phenylbenzene;10-pyridin-2-yl-1H-phenoxazin-1-ide is sourced from PubChem (CID 23569953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).