About iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide
iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide (PubChem CID 23569966) has the molecular formula C22H23IrN2O3-
and a molecular weight of 555.65 g/mol. Its IUPAC name is iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide.
Molecular Properties
| Compound Name | iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide |
| PubChem CID | 23569966 |
| Molecular Formula | C22H23IrN2O3- |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide |
| SMILES | CC(O)CC(C)O.[Ir].[c-]1cccc2c1N(c1ccccn1)c1ccccc1O2 |
| InChI | InChI=1S/C17H11N2O.C5H12O2.Ir/c1-3-9-15-13(7-1)19(17-11-5-6-12-18-17)14-8-2-4-10-16(14)20-15;1-4(6)3-5(2)7;/h1-7,9-12H;4-7H,3H2,1-2H3;/q-1;; |
| InChIKey | ZZZJTGUKMZKEOG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 65.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide?
The IUPAC name of iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide (CID 23569966) is iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide.
What is the SMILES notation for iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide?
The canonical SMILES for iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide is CC(O)CC(C)O.[Ir].[c-]1cccc2c1N(c1ccccn1)c1ccccc1O2.
What is the InChIKey of iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide?
The InChIKey is ZZZJTGUKMZKEOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11N2O.C5H12O2.Ir/c1-3-9-15-13(7-1)19(17-11-5-6-12-18-17)14-8-2-4-10-16(14)20-15;1-4(6)3-5(2)7;/h1-7,9-12H;4-7H,3H2,1-2H3;/q-1;;.
What are the key properties of iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide?
iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide has a molecular weight of 555.65 g/mol, XLogP of 4.59, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;pentane-2,4-diol;10-pyridin-2-yl-1H-phenoxazin-1-ide is sourced from PubChem (CID 23569966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).