About N,N-dimethylmethanamine;yttrium(3+)
N,N-dimethylmethanamine;yttrium(3+) (PubChem CID 23570199) has the molecular formula C3H9NY+3
and a molecular weight of 148.02 g/mol. Its IUPAC name is N,N-dimethylmethanamine;yttrium(3+).
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;yttrium(3+) |
| PubChem CID | 23570199 |
| Molecular Formula | C3H9NY+3 |
| Molecular Weight | 148.02 g/mol |
| Exact Mass | 147.98 |
| IUPAC Name | N,N-dimethylmethanamine;yttrium(3+) |
| SMILES | CN(C)C.[Y+3] |
| InChI | InChI=1S/C3H9N.Y/c1-4(2)3;/h1-3H3;/q;+3 |
| InChIKey | HPWDOJIUMZABAO-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.02 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylmethanamine;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;yttrium(3+)?
The IUPAC name of N,N-dimethylmethanamine;yttrium(3+) (CID 23570199) is N,N-dimethylmethanamine;yttrium(3+).
What is the SMILES notation for N,N-dimethylmethanamine;yttrium(3+)?
The canonical SMILES for N,N-dimethylmethanamine;yttrium(3+) is CN(C)C.[Y+3].
What is the InChIKey of N,N-dimethylmethanamine;yttrium(3+)?
The InChIKey is HPWDOJIUMZABAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.Y/c1-4(2)3;/h1-3H3;/q;+3.
What are the key properties of N,N-dimethylmethanamine;yttrium(3+)?
N,N-dimethylmethanamine;yttrium(3+) has a molecular weight of 148.02 g/mol, XLogP of 0.18, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;yttrium(3+) is sourced from PubChem (CID 23570199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).