About phenylmethylbenzene;tungsten(2+)
phenylmethylbenzene;tungsten(2+) (PubChem CID 23570247) has the molecular formula C13H10W
and a molecular weight of 350.06 g/mol. Its IUPAC name is phenylmethylbenzene;tungsten(2+).
Molecular Properties
| Compound Name | phenylmethylbenzene;tungsten(2+) |
| PubChem CID | 23570247 |
| Molecular Formula | C13H10W |
| Molecular Weight | 350.06 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | phenylmethylbenzene;tungsten(2+) |
| SMILES | [W+2].[c-]1ccccc1Cc1[c-]cccc1 |
| InChI | InChI=1S/C13H10.W/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1-7,9H,11H2;/q-2;+2 |
| InChIKey | JXCKEQHCUUPJGC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.06 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze phenylmethylbenzene;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethylbenzene;tungsten(2+)?
The IUPAC name of phenylmethylbenzene;tungsten(2+) (CID 23570247) is phenylmethylbenzene;tungsten(2+).
What is the SMILES notation for phenylmethylbenzene;tungsten(2+)?
The canonical SMILES for phenylmethylbenzene;tungsten(2+) is [W+2].[c-]1ccccc1Cc1[c-]cccc1.
What is the InChIKey of phenylmethylbenzene;tungsten(2+)?
The InChIKey is JXCKEQHCUUPJGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10.W/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1-7,9H,11H2;/q-2;+2.
What are the key properties of phenylmethylbenzene;tungsten(2+)?
phenylmethylbenzene;tungsten(2+) has a molecular weight of 350.06 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethylbenzene;tungsten(2+) is sourced from PubChem (CID 23570247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).