About 4-propan-2-yl-1H-1,2,4-triazol-5-one
4-propan-2-yl-1H-1,2,4-triazol-5-one (PubChem CID 23570752) has the molecular formula C5H9N3O
and a molecular weight of 127.15 g/mol. Its IUPAC name is 4-propan-2-yl-1H-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 4-propan-2-yl-1H-1,2,4-triazol-5-one |
| PubChem CID | 23570752 |
| Molecular Formula | C5H9N3O |
| Molecular Weight | 127.15 g/mol |
| Exact Mass | 127.07 |
| IUPAC Name | 4-propan-2-yl-1H-1,2,4-triazol-5-one |
| SMILES | CC(C)n1cn[nH]c1=O |
| InChI | InChI=1S/C5H9N3O/c1-4(2)8-3-6-7-5(8)9/h3-4H,1-2H3,(H,7,9) |
| InChIKey | HBDHPSKSXDZHAG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.15 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-propan-2-yl-1H-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-yl-1H-1,2,4-triazol-5-one?
The IUPAC name of 4-propan-2-yl-1H-1,2,4-triazol-5-one (CID 23570752) is 4-propan-2-yl-1H-1,2,4-triazol-5-one.
What is the SMILES notation for 4-propan-2-yl-1H-1,2,4-triazol-5-one?
The canonical SMILES for 4-propan-2-yl-1H-1,2,4-triazol-5-one is CC(C)n1cn[nH]c1=O.
What is the InChIKey of 4-propan-2-yl-1H-1,2,4-triazol-5-one?
The InChIKey is HBDHPSKSXDZHAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O/c1-4(2)8-3-6-7-5(8)9/h3-4H,1-2H3,(H,7,9).
What are the key properties of 4-propan-2-yl-1H-1,2,4-triazol-5-one?
4-propan-2-yl-1H-1,2,4-triazol-5-one has a molecular weight of 127.15 g/mol, XLogP of 0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-yl-1H-1,2,4-triazol-5-one is sourced from PubChem (CID 23570752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).