About 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide
4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide (PubChem CID 23570856) has the molecular formula C29H25Cl2N5O
and a molecular weight of 530.46 g/mol. Its IUPAC name is 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide.
Molecular Properties
| Compound Name | 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide |
| PubChem CID | 23570856 |
| Molecular Formula | C29H25Cl2N5O |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 529.14 |
| IUPAC Name | 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide |
| SMILES | NCCC(C(=O)Nc1ccc2[nH]nc(Nc3cccc(-c4ccccc4)c3)c2c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H25Cl2N5O/c30-25-11-9-20(16-26(25)31)23(13-14-32)29(37)34-22-10-12-27-24(17-22)28(36-35-27)33-21-8-4-7-19(15-21)18-5-2-1-3-6-18/h1-12,15-17,23H,13-14,32H2,(H,34,37)(H2,33,35,36) |
| InChIKey | YEQMBQFDDFHTHJ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide?
The IUPAC name of 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide (CID 23570856) is 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide.
What is the SMILES notation for 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide?
The canonical SMILES for 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide is NCCC(C(=O)Nc1ccc2[nH]nc(Nc3cccc(-c4ccccc4)c3)c2c1)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide?
The InChIKey is YEQMBQFDDFHTHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H25Cl2N5O/c30-25-11-9-20(16-26(25)31)23(13-14-32)29(37)34-22-10-12-27-24(17-22)28(36-35-27)33-21-8-4-7-19(15-21)18-5-2-1-3-6-18/h1-12,15-17,23H,13-14,32H2,(H,34,37)(H2,33,35,36).
What are the key properties of 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide?
4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide has a molecular weight of 530.46 g/mol, XLogP of 7.35, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-(3,4-dichlorophenyl)-N-[3-(3-phenylanilino)-1H-indazol-5-yl]butanamide is sourced from PubChem (CID 23570856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).