C17H19F3N2O4S — CID 23571113
(1'R,4R,10'S)-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-carboxylic acid (PubChem CID 23571113) has the molecular formula C17H19F3N2O4S and a molecular weight of 404.41 g/mol. Its IUPAC name is (1'R,4R,10'S)-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-carboxylic acid.
| Compound Name | (1'R,4R,10'S)-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-carboxylic acid |
|---|---|
| PubChem CID | 23571113 |
| Molecular Formula | C17H19F3N2O4S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | (1'R,4R,10'S)-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C[C@H]1CC[C@@H](C2)[C@]12CN(CC(F)(F)F)S(=O)(=O)N2 |
| InChI | InChI=1S/C17H19F3N2O4S/c18-17(19,20)9-22-8-16(21-27(22,25)26)13-3-4-14(16)7-12-5-11(15(23)24)2-1-10(12)6-13/h1-2,5,13-14,21H,3-4,6-9H2,(H,23,24)/t13-,14+,16+/m0/s1 |
| InChIKey | BEVXBMOWTFDNGL-SQWLQELKSA-N |
| XLogP | 1.96 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |