C21H34O6 — CID 23571672
[3-[8-methyl-1-(prop-1-en-2-yloxymethoxy)non-8-en-2-yl]oxy-3-oxopropyl] 2-methylprop-2-enoate (PubChem CID 23571672) has the molecular formula C21H34O6 and a molecular weight of 382.50 g/mol. Its IUPAC name is [3-[8-methyl-1-(prop-1-en-2-yloxymethoxy)non-8-en-2-yl]oxy-3-oxopropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[8-methyl-1-(prop-1-en-2-yloxymethoxy)non-8-en-2-yl]oxy-3-oxopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 23571672 |
| Molecular Formula | C21H34O6 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | [3-[8-methyl-1-(prop-1-en-2-yloxymethoxy)non-8-en-2-yl]oxy-3-oxopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)CCCCCC(COCOC(=C)C)OC(=O)CCOC(=O)C(=C)C |
| InChI | InChI=1S/C21H34O6/c1-16(2)10-8-7-9-11-19(14-24-15-26-18(5)6)27-20(22)12-13-25-21(23)17(3)4/h19H,1,3,5,7-15H2,2,4,6H3 |
| InChIKey | JFEOZNQFBFSNNO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|