C27H48O4 — CID 23571745
2,14-dimethyl-8,8-bis(prop-1-en-2-yloxymethoxymethyl)pentadeca-1,14-diene (PubChem CID 23571745) has the molecular formula C27H48O4 and a molecular weight of 436.68 g/mol. Its IUPAC name is 2,14-dimethyl-8,8-bis(prop-1-en-2-yloxymethoxymethyl)pentadeca-1,14-diene.
| Compound Name | 2,14-dimethyl-8,8-bis(prop-1-en-2-yloxymethoxymethyl)pentadeca-1,14-diene |
|---|---|
| PubChem CID | 23571745 |
| Molecular Formula | C27H48O4 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.36 |
| IUPAC Name | 2,14-dimethyl-8,8-bis(prop-1-en-2-yloxymethoxymethyl)pentadeca-1,14-diene |
| SMILES | C=C(C)CCCCCC(CCCCCC(=C)C)(COCOC(=C)C)COCOC(=C)C |
| InChI | InChI=1S/C27H48O4/c1-23(2)15-11-9-13-17-27(19-28-21-30-25(5)6,20-29-22-31-26(7)8)18-14-10-12-16-24(3)4/h1,3,5,7,9-22H2,2,4,6,8H3 |
| InChIKey | HCUSOPLVVSDVAV-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|