C30H54O9 — CID 23571746
2-methyl-9-[2-(prop-1-en-2-yloxymethoxy)ethoxy]-8,8-bis[2-(prop-1-en-2-yloxymethoxy)ethoxymethyl]non-1-ene (PubChem CID 23571746) has the molecular formula C30H54O9 and a molecular weight of 558.75 g/mol. Its IUPAC name is 2-methyl-9-[2-(prop-1-en-2-yloxymethoxy)ethoxy]-8,8-bis[2-(prop-1-en-2-yloxymethoxy)ethoxymethyl]non-1-ene.
| Compound Name | 2-methyl-9-[2-(prop-1-en-2-yloxymethoxy)ethoxy]-8,8-bis[2-(prop-1-en-2-yloxymethoxy)ethoxymethyl]non-1-ene |
|---|---|
| PubChem CID | 23571746 |
| Molecular Formula | C30H54O9 |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | 2-methyl-9-[2-(prop-1-en-2-yloxymethoxy)ethoxy]-8,8-bis[2-(prop-1-en-2-yloxymethoxy)ethoxymethyl]non-1-ene |
| SMILES | C=C(C)CCCCCC(COCCOCOC(=C)C)(COCCOCOC(=C)C)COCCOCOC(=C)C |
| InChI | InChI=1S/C30H54O9/c1-26(2)12-10-9-11-13-30(20-31-14-17-34-23-37-27(3)4,21-32-15-18-35-24-38-28(5)6)22-33-16-19-36-25-39-29(7)8/h1,3,5,7,9-25H2,2,4,6,8H3 |
| InChIKey | XHBCGZHPGPGSSI-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|