C16H18F12O3 — CID 23571804
[1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] butanoate (PubChem CID 23571804) has the molecular formula C16H18F12O3 and a molecular weight of 486.29 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] butanoate.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] butanoate |
|---|---|
| PubChem CID | 23571804 |
| Molecular Formula | C16H18F12O3 |
| Molecular Weight | 486.29 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl]propan-2-yl] butanoate |
| SMILES | CCCC(=O)OC(C1CCC(C(O)(C(F)(F)F)C(F)(F)F)CC1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H18F12O3/c1-2-3-10(29)31-12(15(23,24)25,16(26,27)28)9-6-4-8(5-7-9)11(30,13(17,18)19)14(20,21)22/h8-9,30H,2-7H2,1H3 |
| InChIKey | AHWGZYYJTIJROH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.29 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |