C22H31F9O3 — CID 23571829
tert-butyl 5-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]-4-methyl-2-(trifluoromethyl)hexanoate (PubChem CID 23571829) has the molecular formula C22H31F9O3 and a molecular weight of 514.47 g/mol. Its IUPAC name is tert-butyl 5-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]-4-methyl-2-(trifluoromethyl)hexanoate.
| Compound Name | tert-butyl 5-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]-4-methyl-2-(trifluoromethyl)hexanoate |
|---|---|
| PubChem CID | 23571829 |
| Molecular Formula | C22H31F9O3 |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | tert-butyl 5-[6-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]-4-methyl-2-(trifluoromethyl)hexanoate |
| SMILES | CC(CC(C(=O)OC(C)(C)C)C(F)(F)F)C(C)C1CC2CC1C(C(O)(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C22H31F9O3/c1-10(6-16(20(23,24)25)17(32)34-18(3,4)5)11(2)13-7-12-8-14(13)15(9-12)19(33,21(26,27)28)22(29,30)31/h10-16,33H,6-9H2,1-5H3 |
| InChIKey | NOPJPRHPMFQCFO-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |