About 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene
4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene (PubChem CID 23572289) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene.
Molecular Properties
| Compound Name | 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene |
| PubChem CID | 23572289 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene |
| SMILES | C=C=CC(CC)COCCOCC(C=C=C)CC |
| InChI | InChI=1S/C16H26O2/c1-5-9-15(7-3)13-17-11-12-18-14-16(8-4)10-6-2/h9-10,15-16H,1-2,7-8,11-14H2,3-4H3 |
| InChIKey | HZUVICLMEPUJSM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene?
The IUPAC name of 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene (CID 23572289) is 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene.
What is the SMILES notation for 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene?
The canonical SMILES for 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene is C=C=CC(CC)COCCOCC(C=C=C)CC.
What is the InChIKey of 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene?
The InChIKey is HZUVICLMEPUJSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2/c1-5-9-15(7-3)13-17-11-12-18-14-16(8-4)10-6-2/h9-10,15-16H,1-2,7-8,11-14H2,3-4H3.
What are the key properties of 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene?
4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene has a molecular weight of 250.38 g/mol, XLogP of 3.75, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-ethylpenta-3,4-dienoxy)ethoxymethyl]hexa-1,2-diene is sourced from PubChem (CID 23572289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).