C19H28N2O5 — CID 23573035
2-[[1-carboxy-2-[4-(propan-2-ylcarbamoyl)phenyl]ethyl]amino]-4-methylpentanoic acid (PubChem CID 23573035) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2-[[1-carboxy-2-[4-(propan-2-ylcarbamoyl)phenyl]ethyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[1-carboxy-2-[4-(propan-2-ylcarbamoyl)phenyl]ethyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 23573035 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2-[[1-carboxy-2-[4-(propan-2-ylcarbamoyl)phenyl]ethyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(Cc1ccc(C(=O)NC(C)C)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C19H28N2O5/c1-11(2)9-15(18(23)24)21-16(19(25)26)10-13-5-7-14(8-6-13)17(22)20-12(3)4/h5-8,11-12,15-16,21H,9-10H2,1-4H3,(H,20,22)(H,23,24)(H,25,26) |
| InChIKey | IVIARGZZZXAPNT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |