C28H35N3O2 — CID 23573393
1-(cyclohexylmethyl)-5-(3,3-dimethylbutanoylamino)-N-phenylindole-2-carboxamide (PubChem CID 23573393) has the molecular formula C28H35N3O2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-5-(3,3-dimethylbutanoylamino)-N-phenylindole-2-carboxamide.
| Compound Name | 1-(cyclohexylmethyl)-5-(3,3-dimethylbutanoylamino)-N-phenylindole-2-carboxamide |
|---|---|
| PubChem CID | 23573393 |
| Molecular Formula | C28H35N3O2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 1-(cyclohexylmethyl)-5-(3,3-dimethylbutanoylamino)-N-phenylindole-2-carboxamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc2c(c1)cc(C(=O)Nc1ccccc1)n2CC1CCCCC1 |
| InChI | InChI=1S/C28H35N3O2/c1-28(2,3)18-26(32)29-23-14-15-24-21(16-23)17-25(27(33)30-22-12-8-5-9-13-22)31(24)19-20-10-6-4-7-11-20/h5,8-9,12-17,20H,4,6-7,10-11,18-19H2,1-3H3,(H,29,32)(H,30,33) |
| InChIKey | IDVHPSBHJXIQLO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |