C18H23F3O2 — CID 23574083
5-(4-ethylcyclohexyl)-2-(3,4,5-trifluorophenyl)-1,3-dioxane (PubChem CID 23574083) has the molecular formula C18H23F3O2 and a molecular weight of 328.37 g/mol. Its IUPAC name is 5-(4-ethylcyclohexyl)-2-(3,4,5-trifluorophenyl)-1,3-dioxane.
| Compound Name | 5-(4-ethylcyclohexyl)-2-(3,4,5-trifluorophenyl)-1,3-dioxane |
|---|---|
| PubChem CID | 23574083 |
| Molecular Formula | C18H23F3O2 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 5-(4-ethylcyclohexyl)-2-(3,4,5-trifluorophenyl)-1,3-dioxane |
| SMILES | CCC1CCC(C2COC(c3cc(F)c(F)c(F)c3)OC2)CC1 |
| InChI | InChI=1S/C18H23F3O2/c1-2-11-3-5-12(6-4-11)14-9-22-18(23-10-14)13-7-15(19)17(21)16(20)8-13/h7-8,11-12,14,18H,2-6,9-10H2,1H3 |
| InChIKey | DNINTIOURYGFQC-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|