C24H26F6N2O3 — CID 23574734
6-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-3-[(E)-N-hydroxy-C-methylcarbonimidoyl]-6-phenylpiperidin-3-ol (PubChem CID 23574734) has the molecular formula C24H26F6N2O3 and a molecular weight of 504.47 g/mol. Its IUPAC name is 6-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-3-[(E)-N-hydroxy-C-methylcarbonimidoyl]-6-phenylpiperidin-3-ol.
| Compound Name | 6-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-3-[(E)-N-hydroxy-C-methylcarbonimidoyl]-6-phenylpiperidin-3-ol |
|---|---|
| PubChem CID | 23574734 |
| Molecular Formula | C24H26F6N2O3 |
| Molecular Weight | 504.47 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 6-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxymethyl]-3-[(E)-N-hydroxy-C-methylcarbonimidoyl]-6-phenylpiperidin-3-ol |
| SMILES | C/C(=N\O)C1(O)CCC(COC(C)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2ccccc2)NC1 |
| InChI | InChI=1S/C24H26F6N2O3/c1-15(17-10-19(23(25,26)27)12-20(11-17)24(28,29)30)35-14-21(18-6-4-3-5-7-18)8-9-22(33,13-31-21)16(2)32-34/h3-7,10-12,15,31,33-34H,8-9,13-14H2,1-2H3/b32-16+ |
| InChIKey | ATDMNYPNZLHHBF-KPGMTVGESA-N |
| XLogP | 5.66 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|