C40H14O2S2 — CID 23576554
2-[2,5-bis(dodeca-1,3,5,7,9,11-hexaynoxy)-4-(5-methylthiophen-2-yl)phenyl]-5-methylthiophene (PubChem CID 23576554) has the molecular formula C40H14O2S2 and a molecular weight of 590.68 g/mol. Its IUPAC name is 2-[2,5-bis(dodeca-1,3,5,7,9,11-hexaynoxy)-4-(5-methylthiophen-2-yl)phenyl]-5-methylthiophene.
| Compound Name | 2-[2,5-bis(dodeca-1,3,5,7,9,11-hexaynoxy)-4-(5-methylthiophen-2-yl)phenyl]-5-methylthiophene |
|---|---|
| PubChem CID | 23576554 |
| Molecular Formula | C40H14O2S2 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.04 |
| IUPAC Name | 2-[2,5-bis(dodeca-1,3,5,7,9,11-hexaynoxy)-4-(5-methylthiophen-2-yl)phenyl]-5-methylthiophene |
| SMILES | C#CC#CC#CC#CC#CC#COc1cc(-c2ccc(C)s2)c(OC#CC#CC#CC#CC#CC#C)cc1-c1ccc(C)s1 |
| InChI | InChI=1S/C40H14O2S2/c1-5-7-9-11-13-15-17-19-21-23-29-41-37-31-36(40-28-26-34(4)44-40)38(32-35(37)39-27-25-33(3)43-39)42-30-24-22-20-18-16-14-12-10-8-6-2/h1-2,25-28,31-32H,3-4H3 |
| InChIKey | JMKMDQDATPGFSK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|