C53H32N4O4 — CID 23576783
2-[4-[tris[4-(1,3-benzoxazol-2-yl)phenyl]methyl]phenyl]-1,3-benzoxazole (PubChem CID 23576783) has the molecular formula C53H32N4O4 and a molecular weight of 788.86 g/mol. Its IUPAC name is 2-[4-[tris[4-(1,3-benzoxazol-2-yl)phenyl]methyl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[4-[tris[4-(1,3-benzoxazol-2-yl)phenyl]methyl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 23576783 |
| Molecular Formula | C53H32N4O4 |
| Molecular Weight | 788.86 g/mol |
| Exact Mass | 788.24 |
| IUPAC Name | 2-[4-[tris[4-(1,3-benzoxazol-2-yl)phenyl]methyl]phenyl]-1,3-benzoxazole |
| SMILES | c1ccc2oc(-c3ccc(C(c4ccc(-c5nc6ccccc6o5)cc4)(c4ccc(-c5nc6ccccc6o5)cc4)c4ccc(-c5nc6ccccc6o5)cc4)cc3)nc2c1 |
| InChI | InChI=1S/C53H32N4O4/c1-5-13-45-41(9-1)54-49(58-45)33-17-25-37(26-18-33)53(38-27-19-34(20-28-38)50-55-42-10-2-6-14-46(42)59-50,39-29-21-35(22-30-39)51-56-43-11-3-7-15-47(43)60-51)40-31-23-36(24-32-40)52-57-44-12-4-8-16-48(44)61-52/h1-32H |
| InChIKey | TXYLAKMQGRUERA-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 104.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.86 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|