C13H24N2O2 — CID 23577313
tert-butyl N-(8-azabicyclo[3.2.1]octan-3-ylmethyl)carbamate (PubChem CID 23577313) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is tert-butyl N-(8-azabicyclo[3.2.1]octan-3-ylmethyl)carbamate.
| Compound Name | tert-butyl N-(8-azabicyclo[3.2.1]octan-3-ylmethyl)carbamate |
|---|---|
| PubChem CID | 23577313 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | tert-butyl N-(8-azabicyclo[3.2.1]octan-3-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C13H24N2O2/c1-13(2,3)17-12(16)14-8-9-6-10-4-5-11(7-9)15-10/h9-11,15H,4-8H2,1-3H3,(H,14,16) |
| InChIKey | KAVQNCGGFFBHEO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |