C25H33N3O2 — CID 23577316
tert-butyl N-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]-N-pyridin-4-ylcarbamate (PubChem CID 23577316) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is tert-butyl N-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]-N-pyridin-4-ylcarbamate.
| Compound Name | tert-butyl N-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]-N-pyridin-4-ylcarbamate |
|---|---|
| PubChem CID | 23577316 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | tert-butyl N-[(8-benzyl-8-azabicyclo[3.2.1]octan-3-yl)methyl]-N-pyridin-4-ylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(CC1CC2CCC(C1)N2Cc1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C25H33N3O2/c1-25(2,3)30-24(29)28(21-11-13-26-14-12-21)18-20-15-22-9-10-23(16-20)27(22)17-19-7-5-4-6-8-19/h4-8,11-14,20,22-23H,9-10,15-18H2,1-3H3 |
| InChIKey | SBJAIMZUFKUNBF-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |