C32H29Cl2N3O — CID 23577791
N-[[4-(3-chlorophenyl)-6-[(4-chlorophenyl)-pyridin-3-ylmethyl]quinolin-2-yl]methyl]-3-methoxypropan-1-amine (PubChem CID 23577791) has the molecular formula C32H29Cl2N3O and a molecular weight of 542.51 g/mol. Its IUPAC name is N-[[4-(3-chlorophenyl)-6-[(4-chlorophenyl)-pyridin-3-ylmethyl]quinolin-2-yl]methyl]-3-methoxypropan-1-amine.
| Compound Name | N-[[4-(3-chlorophenyl)-6-[(4-chlorophenyl)-pyridin-3-ylmethyl]quinolin-2-yl]methyl]-3-methoxypropan-1-amine |
|---|---|
| PubChem CID | 23577791 |
| Molecular Formula | C32H29Cl2N3O |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | N-[[4-(3-chlorophenyl)-6-[(4-chlorophenyl)-pyridin-3-ylmethyl]quinolin-2-yl]methyl]-3-methoxypropan-1-amine |
| SMILES | COCCCNCc1cc(-c2cccc(Cl)c2)c2cc(C(c3ccc(Cl)cc3)c3cccnc3)ccc2n1 |
| InChI | InChI=1S/C32H29Cl2N3O/c1-38-16-4-15-36-21-28-19-29(23-5-2-7-27(34)17-23)30-18-24(10-13-31(30)37-28)32(25-6-3-14-35-20-25)22-8-11-26(33)12-9-22/h2-3,5-14,17-20,32,36H,4,15-16,21H2,1H3 |
| InChIKey | WVPFQDCSHHBJHO-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|