About (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide
(3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide (PubChem CID 23577875) has the molecular formula C13H27NO3
and a molecular weight of 245.36 g/mol. Its IUPAC name is (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide.
Molecular Properties
| Compound Name | (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide |
| PubChem CID | 23577875 |
| Molecular Formula | C13H27NO3 |
| Molecular Weight | 245.36 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide |
| SMILES | CC(C)CC[C@@H](O)[C@H](O)CC(=O)NCC(C)C |
| InChI | InChI=1S/C13H27NO3/c1-9(2)5-6-11(15)12(16)7-13(17)14-8-10(3)4/h9-12,15-16H,5-8H2,1-4H3,(H,14,17)/t11-,12-/m1/s1 |
| InChIKey | ZUEFSFCZQLWNPY-VXGBXAGGSA-N |
| XLogP | 1.31 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide?
The IUPAC name of (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide (CID 23577875) is (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide.
What is the SMILES notation for (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide?
The canonical SMILES for (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide is CC(C)CC[C@@H](O)[C@H](O)CC(=O)NCC(C)C.
What is the InChIKey of (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide?
The InChIKey is ZUEFSFCZQLWNPY-VXGBXAGGSA-N. The full InChI is InChI=1S/C13H27NO3/c1-9(2)5-6-11(15)12(16)7-13(17)14-8-10(3)4/h9-12,15-16H,5-8H2,1-4H3,(H,14,17)/t11-,12-/m1/s1.
What are the key properties of (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide?
(3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide has a molecular weight of 245.36 g/mol, XLogP of 1.31, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-3,4-dihydroxy-7-methyl-N-(2-methylpropyl)octanamide is sourced from PubChem (CID 23577875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).