About N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium
N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium (PubChem CID 23578225) has the molecular formula C9H13Br2N2Ti-
and a molecular weight of 356.89 g/mol. Its IUPAC name is N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium.
Molecular Properties
| Compound Name | N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium |
| PubChem CID | 23578225 |
| Molecular Formula | C9H13Br2N2Ti- |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 354.89 |
| IUPAC Name | N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium |
| SMILES | Br[Ti]Br.CC(C)(C)/N=C/c1ccc[n-]1 |
| InChI | InChI=1S/C9H13N2.2BrH.Ti/c1-9(2,3)11-7-8-5-4-6-10-8;;;/h4-7H,1-3H3;2*1H;/q-1;;;+2/p-2/b11-7+;;; |
| InChIKey | ABQGOHPPZXVAQU-DLEJXUKQSA-L |
| XLogP | 3.55 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium?
The IUPAC name of N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium (CID 23578225) is N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium.
What is the SMILES notation for N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium?
The canonical SMILES for N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium is Br[Ti]Br.CC(C)(C)/N=C/c1ccc[n-]1.
What is the InChIKey of N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium?
The InChIKey is ABQGOHPPZXVAQU-DLEJXUKQSA-L. The full InChI is InChI=1S/C9H13N2.2BrH.Ti/c1-9(2,3)11-7-8-5-4-6-10-8;;;/h4-7H,1-3H3;2*1H;/q-1;;;+2/p-2/b11-7+;;;.
What are the key properties of N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium?
N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium has a molecular weight of 356.89 g/mol, XLogP of 3.55, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-pyrrol-1-id-2-ylmethanimine;dibromotitanium is sourced from PubChem (CID 23578225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).