C11H4Cl2F5N2Ta- — CID 23578234
dichlorotantalum;N-(2,3,4,5,6-pentafluorophenyl)-1-pyrrol-1-id-2-ylmethanimine (PubChem CID 23578234) has the molecular formula C11H4Cl2F5N2Ta- and a molecular weight of 511.01 g/mol. Its IUPAC name is dichlorotantalum;N-(2,3,4,5,6-pentafluorophenyl)-1-pyrrol-1-id-2-ylmethanimine.
| Compound Name | dichlorotantalum;N-(2,3,4,5,6-pentafluorophenyl)-1-pyrrol-1-id-2-ylmethanimine |
|---|---|
| PubChem CID | 23578234 |
| Molecular Formula | C11H4Cl2F5N2Ta- |
| Molecular Weight | 511.01 g/mol |
| Exact Mass | 509.92 |
| IUPAC Name | dichlorotantalum;N-(2,3,4,5,6-pentafluorophenyl)-1-pyrrol-1-id-2-ylmethanimine |
| SMILES | Cl[Ta]Cl.Fc1c(F)c(F)c(/N=C/c2ccc[n-]2)c(F)c1F |
| InChI | InChI=1S/C11H4F5N2.2ClH.Ta/c12-6-7(13)9(15)11(10(16)8(6)14)18-4-5-2-1-3-17-5;;;/h1-4H;2*1H;/q-1;;;+2/p-2/b18-4+;;; |
| InChIKey | AUTSAVQQPJALSZ-CFXYMQHHSA-L |
| XLogP | 4.47 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.01 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|