C17H16BrNO5 — CID 2357826
[2-(3-methoxyanilino)-2-oxoethyl] 2-(4-bromophenoxy)acetate (PubChem CID 2357826) has the molecular formula C17H16BrNO5 and a molecular weight of 394.22 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl] 2-(4-bromophenoxy)acetate.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl] 2-(4-bromophenoxy)acetate |
|---|---|
| PubChem CID | 2357826 |
| Molecular Formula | C17H16BrNO5 |
| Molecular Weight | 394.22 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl] 2-(4-bromophenoxy)acetate |
| SMILES | COc1cccc(NC(=O)COC(=O)COc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H16BrNO5/c1-22-15-4-2-3-13(9-15)19-16(20)10-24-17(21)11-23-14-7-5-12(18)6-8-14/h2-9H,10-11H2,1H3,(H,19,20) |
| InChIKey | FZTCMFCFEWMZLX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.22 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |