C10H10CrF3NO — CID 23578306
chromium;2,4-dimethyl-6-(2,2,2-trifluoroethylideneamino)phenol (PubChem CID 23578306) has the molecular formula C10H10CrF3NO and a molecular weight of 269.19 g/mol. Its IUPAC name is chromium;2,4-dimethyl-6-(2,2,2-trifluoroethylideneamino)phenol.
| Compound Name | chromium;2,4-dimethyl-6-(2,2,2-trifluoroethylideneamino)phenol |
|---|---|
| PubChem CID | 23578306 |
| Molecular Formula | C10H10CrF3NO |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 269.01 |
| IUPAC Name | chromium;2,4-dimethyl-6-(2,2,2-trifluoroethylideneamino)phenol |
| SMILES | Cc1cc(C)c(O)c(/N=C/C(F)(F)F)c1.[Cr] |
| InChI | InChI=1S/C10H10F3NO.Cr/c1-6-3-7(2)9(15)8(4-6)14-5-10(11,12)13;/h3-5,15H,1-2H3;/b14-5+; |
| InChIKey | PYRFUXDGPGQEGR-OCSIRBNJSA-N |
| XLogP | 3.27 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|