C22H33N3OTi — CID 23579022
bis(dimethylazanide);2,4-dimethyl-6-[(2,4,6-trimethylphenyl)methylideneamino]phenol;titanium(2+) (PubChem CID 23579022) has the molecular formula C22H33N3OTi and a molecular weight of 403.39 g/mol. Its IUPAC name is bis(dimethylazanide);2,4-dimethyl-6-[(2,4,6-trimethylphenyl)methylideneamino]phenol;titanium(2+).
| Compound Name | bis(dimethylazanide);2,4-dimethyl-6-[(2,4,6-trimethylphenyl)methylideneamino]phenol;titanium(2+) |
|---|---|
| PubChem CID | 23579022 |
| Molecular Formula | C22H33N3OTi |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | bis(dimethylazanide);2,4-dimethyl-6-[(2,4,6-trimethylphenyl)methylideneamino]phenol;titanium(2+) |
| SMILES | C[N-]C.C[N-]C.Cc1cc(C)c(/C=N\c2cc(C)cc(C)c2O)c(C)c1.[Ti+2] |
| InChI | InChI=1S/C18H21NO.2C2H6N.Ti/c1-11-6-13(3)16(14(4)7-11)10-19-17-9-12(2)8-15(5)18(17)20;2*1-3-2;/h6-10,20H,1-5H3;2*1-2H3;/q;2*-1;+2/b19-10-;;; |
| InChIKey | CXUCTOHMJYEUKP-UKTXRYPKSA-N |
| XLogP | 5.92 |
| TPSA | 60.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|