About phenacyl 2-thiophen-3-ylacetate
phenacyl 2-thiophen-3-ylacetate (PubChem CID 2357912) has the molecular formula C14H12O3S
and a molecular weight of 260.31 g/mol. Its IUPAC name is phenacyl 2-thiophen-3-ylacetate.
Molecular Properties
| Compound Name | phenacyl 2-thiophen-3-ylacetate |
| PubChem CID | 2357912 |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | phenacyl 2-thiophen-3-ylacetate |
| SMILES | O=C(Cc1ccsc1)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H12O3S/c15-13(12-4-2-1-3-5-12)9-17-14(16)8-11-6-7-18-10-11/h1-7,10H,8-9H2 |
| InChIKey | XAYDVDCNLFZPLM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenacyl 2-thiophen-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenacyl 2-thiophen-3-ylacetate?
The IUPAC name of phenacyl 2-thiophen-3-ylacetate (CID 2357912) is phenacyl 2-thiophen-3-ylacetate.
What is the SMILES notation for phenacyl 2-thiophen-3-ylacetate?
The canonical SMILES for phenacyl 2-thiophen-3-ylacetate is O=C(Cc1ccsc1)OCC(=O)c1ccccc1.
What is the InChIKey of phenacyl 2-thiophen-3-ylacetate?
The InChIKey is XAYDVDCNLFZPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3S/c15-13(12-4-2-1-3-5-12)9-17-14(16)8-11-6-7-18-10-11/h1-7,10H,8-9H2.
What are the key properties of phenacyl 2-thiophen-3-ylacetate?
phenacyl 2-thiophen-3-ylacetate has a molecular weight of 260.31 g/mol, XLogP of 2.72, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenacyl 2-thiophen-3-ylacetate is sourced from PubChem (CID 2357912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).